C24H21Cl2N3O2S — CID 3496669
3-[5-(4-chlorophenyl)furan-2-yl]-N-[(3-chloro-4-pyrrolidin-1-ylphenyl)carbamothioyl]prop-2-enamide (PubChem CID 3496669) has the molecular formula C24H21Cl2N3O2S and a molecular weight of 486.42 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)furan-2-yl]-N-[(3-chloro-4-pyrrolidin-1-ylphenyl)carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[(3-chloro-4-pyrrolidin-1-ylphenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3496669 |
| Molecular Formula | C24H21Cl2N3O2S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[(3-chloro-4-pyrrolidin-1-ylphenyl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2ccc(Cl)cc2)o1)NC(=S)Nc1ccc(N2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C24H21Cl2N3O2S/c25-17-5-3-16(4-6-17)22-11-8-19(31-22)9-12-23(30)28-24(32)27-18-7-10-21(20(26)15-18)29-13-1-2-14-29/h3-12,15H,1-2,13-14H2,(H2,27,28,30,32) |
| InChIKey | KWEFJNCACDJVEN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|