C31H25Cl3N4O3S — CID 17317806
(E)-N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17317806) has the molecular formula C31H25Cl3N4O3S and a molecular weight of 639.99 g/mol. Its IUPAC name is (E)-N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17317806 |
| Molecular Formula | C31H25Cl3N4O3S |
| Molecular Weight | 639.99 g/mol |
| Exact Mass | 638.07 |
| IUPAC Name | (E)-N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2Cl)o1)NC(=S)Nc1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C31H25Cl3N4O3S/c32-21-6-10-24(25(33)18-21)28-12-8-23(41-28)9-13-29(39)36-31(42)35-22-7-11-27(26(34)19-22)37-14-16-38(17-15-37)30(40)20-4-2-1-3-5-20/h1-13,18-19H,14-17H2,(H2,35,36,39,42)/b13-9+ |
| InChIKey | MPAZQFHRFHQMCN-UKTHLTGXSA-N |
| XLogP | 7.40 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.99 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|