C27H25ClN4O2S — CID 17116204
(E)-N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 17116204) has the molecular formula C27H25ClN4O2S and a molecular weight of 505.04 g/mol. Its IUPAC name is (E)-N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 17116204 |
| Molecular Formula | C27H25ClN4O2S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | (E)-N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(=S)Nc1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C27H25ClN4O2S/c28-23-19-22(29-27(35)30-25(33)14-11-20-7-3-1-4-8-20)12-13-24(23)31-15-17-32(18-16-31)26(34)21-9-5-2-6-10-21/h1-14,19H,15-18H2,(H2,29,30,33,35)/b14-11+ |
| InChIKey | OXULJMNXYBGVBM-SDNWHVSQSA-N |
| XLogP | 4.83 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|