C27H26Cl2N4OS — CID 4648229
N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 4648229) has the molecular formula C27H26Cl2N4OS and a molecular weight of 525.51 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 4648229 |
| Molecular Formula | C27H26Cl2N4OS |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)NC(=S)Nc1ccc(N2CCN(Cc3ccccc3Cl)CC2)c(Cl)c1 |
| InChI | InChI=1S/C27H26Cl2N4OS/c28-23-9-5-4-8-21(23)19-32-14-16-33(17-15-32)25-12-11-22(18-24(25)29)30-27(35)31-26(34)13-10-20-6-2-1-3-7-20/h1-13,18H,14-17,19H2,(H2,30,31,34,35) |
| InChIKey | CMQINKQBIQTYNO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|