C29H32Cl2N4O2S — CID 3334114
3-butoxy-N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 3334114) has the molecular formula C29H32Cl2N4O2S and a molecular weight of 571.57 g/mol. Its IUPAC name is 3-butoxy-N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-butoxy-N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3334114 |
| Molecular Formula | C29H32Cl2N4O2S |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | 3-butoxy-N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)NC(=S)Nc2ccc(N3CCN(Cc4ccccc4Cl)CC3)c(Cl)c2)c1 |
| InChI | InChI=1S/C29H32Cl2N4O2S/c1-2-3-17-37-24-9-6-8-21(18-24)28(36)33-29(38)32-23-11-12-27(26(31)19-23)35-15-13-34(14-16-35)20-22-7-4-5-10-25(22)30/h4-12,18-19H,2-3,13-17,20H2,1H3,(H2,32,33,36,38) |
| InChIKey | MRBJXCPPVFBJFJ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|