C23H27ClN4O3S — CID 17116177
N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-propan-2-yloxybenzamide (PubChem CID 17116177) has the molecular formula C23H27ClN4O3S and a molecular weight of 475.01 g/mol. Its IUPAC name is N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-propan-2-yloxybenzamide.
| Compound Name | N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 17116177 |
| Molecular Formula | C23H27ClN4O3S |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-propan-2-yloxybenzamide |
| SMILES | CC(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3cccc(OC(C)C)c3)cc2Cl)CC1 |
| InChI | InChI=1S/C23H27ClN4O3S/c1-15(2)31-19-6-4-5-17(13-19)22(30)26-23(32)25-18-7-8-21(20(24)14-18)28-11-9-27(10-12-28)16(3)29/h4-8,13-15H,9-12H2,1-3H3,(H2,25,26,30,32) |
| InChIKey | ZFBAMRVNNFIWNO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|