C20H20BrClN4O2S — CID 17116163
N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-bromobenzamide (PubChem CID 17116163) has the molecular formula C20H20BrClN4O2S and a molecular weight of 495.83 g/mol. Its IUPAC name is N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-bromobenzamide.
| Compound Name | N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-bromobenzamide |
|---|---|
| PubChem CID | 17116163 |
| Molecular Formula | C20H20BrClN4O2S |
| Molecular Weight | 495.83 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-bromobenzamide |
| SMILES | CC(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3cccc(Br)c3)cc2Cl)CC1 |
| InChI | InChI=1S/C20H20BrClN4O2S/c1-13(27)25-7-9-26(10-8-25)18-6-5-16(12-17(18)22)23-20(29)24-19(28)14-3-2-4-15(21)11-14/h2-6,11-12H,7-10H2,1H3,(H2,23,24,28,29) |
| InChIKey | GLPBUCBMSJZJOM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.83 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|