C21H22ClFN4O2S — CID 17110010
N-[[3-chloro-4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]-3-fluorobenzamide (PubChem CID 17110010) has the molecular formula C21H22ClFN4O2S and a molecular weight of 448.95 g/mol. Its IUPAC name is N-[[3-chloro-4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]-3-fluorobenzamide.
| Compound Name | N-[[3-chloro-4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 17110010 |
| Molecular Formula | C21H22ClFN4O2S |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-[[3-chloro-4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]-3-fluorobenzamide |
| SMILES | CCC(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3cccc(F)c3)cc2Cl)CC1 |
| InChI | InChI=1S/C21H22ClFN4O2S/c1-2-19(28)27-10-8-26(9-11-27)18-7-6-16(13-17(18)22)24-21(30)25-20(29)14-4-3-5-15(23)12-14/h3-7,12-13H,2,8-11H2,1H3,(H2,24,25,29,30) |
| InChIKey | UGUMGOSMZFIWMH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|