C23H20ClFN4O3S — CID 17116278
N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-3-fluorobenzamide (PubChem CID 17116278) has the molecular formula C23H20ClFN4O3S and a molecular weight of 486.96 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-3-fluorobenzamide.
| Compound Name | N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 17116278 |
| Molecular Formula | C23H20ClFN4O3S |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-3-fluorobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)c(Cl)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C23H20ClFN4O3S/c24-18-14-17(26-23(33)27-21(30)15-3-1-4-16(25)13-15)6-7-19(18)28-8-10-29(11-9-28)22(31)20-5-2-12-32-20/h1-7,12-14H,8-11H2,(H2,26,27,30,33) |
| InChIKey | MKNOQZUNVYUFAY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|