C24H22BrClN4O4S — CID 17318017
5-bromo-N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 17318017) has the molecular formula C24H22BrClN4O4S and a molecular weight of 577.89 g/mol. Its IUPAC name is 5-bromo-N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 5-bromo-N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 17318017 |
| Molecular Formula | C24H22BrClN4O4S |
| Molecular Weight | 577.89 g/mol |
| Exact Mass | 576.02 |
| IUPAC Name | 5-bromo-N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C24H22BrClN4O4S/c1-33-20-7-4-15(25)13-17(20)22(31)28-24(35)27-16-5-6-19(18(26)14-16)29-8-10-30(11-9-29)23(32)21-3-2-12-34-21/h2-7,12-14H,8-11H2,1H3,(H2,27,28,31,35) |
| InChIKey | JEHBRNJIIPSTDA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.89 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|