C23H21Cl2N3O4 — CID 17118184
5-chloro-N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2-methoxybenzamide (PubChem CID 17118184) has the molecular formula C23H21Cl2N3O4 and a molecular weight of 474.34 g/mol. Its IUPAC name is 5-chloro-N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 17118184 |
| Molecular Formula | C23H21Cl2N3O4 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 5-chloro-N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C23H21Cl2N3O4/c1-31-20-7-4-15(24)13-17(20)22(29)26-16-5-6-19(18(25)14-16)27-8-10-28(11-9-27)23(30)21-3-2-12-32-21/h2-7,12-14H,8-11H2,1H3,(H,26,29) |
| InChIKey | IQYVVYROLDJUGD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|