C26H21Cl2N3O4 — CID 17118198
N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-5-(3-chlorophenyl)furan-2-carboxamide (PubChem CID 17118198) has the molecular formula C26H21Cl2N3O4 and a molecular weight of 510.38 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-5-(3-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-5-(3-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17118198 |
| Molecular Formula | C26H21Cl2N3O4 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-5-(3-chlorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)c(Cl)c1)c1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C26H21Cl2N3O4/c27-18-4-1-3-17(15-18)22-8-9-23(35-22)25(32)29-19-6-7-21(20(28)16-19)30-10-12-31(13-11-30)26(33)24-5-2-14-34-24/h1-9,14-16H,10-13H2,(H,29,32) |
| InChIKey | JLIVSMXUIRQPSJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 78.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|