C27H22Cl2N4O3S2 — CID 17317898
5-(3-chlorophenyl)-N-[[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17317898) has the molecular formula C27H22Cl2N4O3S2 and a molecular weight of 585.54 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-[[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-[[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17317898 |
| Molecular Formula | C27H22Cl2N4O3S2 |
| Molecular Weight | 585.54 g/mol |
| Exact Mass | 584.05 |
| IUPAC Name | 5-(3-chlorophenyl)-N-[[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3cccs3)CC2)c(Cl)c1)c1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C27H22Cl2N4O3S2/c28-18-4-1-3-17(15-18)22-8-9-23(36-22)25(34)31-27(37)30-19-6-7-21(20(29)16-19)32-10-12-33(13-11-32)26(35)24-5-2-14-38-24/h1-9,14-16H,10-13H2,(H2,30,31,34,37) |
| InChIKey | CHVWYRZUQVSBMS-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|