C21H19ClN4O2S3 — CID 17116228
N-[[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 17116228) has the molecular formula C21H19ClN4O2S3 and a molecular weight of 491.06 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17116228 |
| Molecular Formula | C21H19ClN4O2S3 |
| Molecular Weight | 491.06 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | N-[[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3cccs3)CC2)c(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C21H19ClN4O2S3/c22-15-13-14(23-21(29)24-19(27)17-3-1-11-30-17)5-6-16(15)25-7-9-26(10-8-25)20(28)18-4-2-12-31-18/h1-6,11-13H,7-10H2,(H2,23,24,27,29) |
| InChIKey | IDSXBJFYMIBLMS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.06 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|