C24H24ClN3O2S — CID 1295105
N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-3,5-dimethylbenzamide (PubChem CID 1295105) has the molecular formula C24H24ClN3O2S and a molecular weight of 454.00 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-3,5-dimethylbenzamide.
| Compound Name | N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 1295105 |
| Molecular Formula | C24H24ClN3O2S |
| Molecular Weight | 454.00 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)Nc2ccc(N3CCN(C(=O)c4cccs4)CC3)c(Cl)c2)c1 |
| InChI | InChI=1S/C24H24ClN3O2S/c1-16-12-17(2)14-18(13-16)23(29)26-19-5-6-21(20(25)15-19)27-7-9-28(10-8-27)24(30)22-4-3-11-31-22/h3-6,11-15H,7-10H2,1-2H3,(H,26,29) |
| InChIKey | NSRZEKWDTOZFAO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.00 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|