C26H20Cl3N3O3S — CID 17319329
N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 17319329) has the molecular formula C26H20Cl3N3O3S and a molecular weight of 560.89 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17319329 |
| Molecular Formula | C26H20Cl3N3O3S |
| Molecular Weight | 560.89 g/mol |
| Exact Mass | 559.03 |
| IUPAC Name | N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3cccs3)CC2)c(Cl)c1)c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C26H20Cl3N3O3S/c27-16-3-5-18(19(28)14-16)22-7-8-23(35-22)25(33)30-17-4-6-21(20(29)15-17)31-9-11-32(12-10-31)26(34)24-2-1-13-36-24/h1-8,13-15H,9-12H2,(H,30,33) |
| InChIKey | ORWBSBVMQRJIME-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.89 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|