C23H21Cl3N4O2S — CID 17318351
N-[[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 17318351) has the molecular formula C23H21Cl3N4O2S and a molecular weight of 523.87 g/mol. Its IUPAC name is N-[[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17318351 |
| Molecular Formula | C23H21Cl3N4O2S |
| Molecular Weight | 523.87 g/mol |
| Exact Mass | 522.05 |
| IUPAC Name | N-[[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=S)NC(=O)c3ccc(-c4ccc(Cl)cc4Cl)o3)cc2Cl)CC1 |
| InChI | InChI=1S/C23H21Cl3N4O2S/c1-29-8-10-30(11-9-29)19-5-3-15(13-18(19)26)27-23(33)28-22(31)21-7-6-20(32-21)16-4-2-14(24)12-17(16)25/h2-7,12-13H,8-11H2,1H3,(H2,27,28,31,33) |
| InChIKey | BCMICNLMKSFDCR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.87 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|