C29H25Cl3N4O2S — CID 17318115
N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 17318115) has the molecular formula C29H25Cl3N4O2S and a molecular weight of 599.97 g/mol. Its IUPAC name is N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17318115 |
| Molecular Formula | C29H25Cl3N4O2S |
| Molecular Weight | 599.97 g/mol |
| Exact Mass | 598.08 |
| IUPAC Name | N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(Cc3ccccc3Cl)CC2)cc1)c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C29H25Cl3N4O2S/c30-20-5-10-23(25(32)17-20)26-11-12-27(38-26)28(37)34-29(39)33-21-6-8-22(9-7-21)36-15-13-35(14-16-36)18-19-3-1-2-4-24(19)31/h1-12,17H,13-16,18H2,(H2,33,34,37,39) |
| InChIKey | HXQBKWHYSSPXNT-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.97 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|