C20H16Cl2N2O2S — CID 22777171
5-(2,4-dichlorophenyl)-N-[(3,5-dimethylphenyl)carbamothioyl]furan-2-carboxamide (PubChem CID 22777171) has the molecular formula C20H16Cl2N2O2S and a molecular weight of 419.33 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-N-[(3,5-dimethylphenyl)carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2,4-dichlorophenyl)-N-[(3,5-dimethylphenyl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 22777171 |
| Molecular Formula | C20H16Cl2N2O2S |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-N-[(3,5-dimethylphenyl)carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=S)NC(=O)c2ccc(-c3ccc(Cl)cc3Cl)o2)c1 |
| InChI | InChI=1S/C20H16Cl2N2O2S/c1-11-7-12(2)9-14(8-11)23-20(27)24-19(25)18-6-5-17(26-18)15-4-3-13(21)10-16(15)22/h3-10H,1-2H3,(H2,23,24,25,27) |
| InChIKey | KIJOGDHCGWZOPO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|