C23H21Cl2N3O4S — CID 17115574
5-(2,4-dichlorophenyl)-N-[[3-methoxy-4-(2-methylpropanoylamino)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17115574) has the molecular formula C23H21Cl2N3O4S and a molecular weight of 506.41 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-N-[[3-methoxy-4-(2-methylpropanoylamino)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2,4-dichlorophenyl)-N-[[3-methoxy-4-(2-methylpropanoylamino)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17115574 |
| Molecular Formula | C23H21Cl2N3O4S |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-N-[[3-methoxy-4-(2-methylpropanoylamino)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | COc1cc(NC(=S)NC(=O)c2ccc(-c3ccc(Cl)cc3Cl)o2)ccc1NC(=O)C(C)C |
| InChI | InChI=1S/C23H21Cl2N3O4S/c1-12(2)21(29)27-17-7-5-14(11-20(17)31-3)26-23(33)28-22(30)19-9-8-18(32-19)15-6-4-13(24)10-16(15)25/h4-12H,1-3H3,(H,27,29)(H2,26,28,30,33) |
| InChIKey | ZWMINSYURKITAW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|