C26H18Cl3N3O4S — CID 17317119
N-[[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]carbamothioyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide (PubChem CID 17317119) has the molecular formula C26H18Cl3N3O4S and a molecular weight of 574.87 g/mol. Its IUPAC name is N-[[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]carbamothioyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]carbamothioyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17317119 |
| Molecular Formula | C26H18Cl3N3O4S |
| Molecular Weight | 574.87 g/mol |
| Exact Mass | 573.01 |
| IUPAC Name | N-[[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]carbamothioyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide |
| SMILES | COc1cc(NC(=S)NC(=O)c2ccc(-c3cc(Cl)ccc3Cl)o2)ccc1NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C26H18Cl3N3O4S/c1-35-23-13-15(7-9-20(23)31-24(33)16-4-2-3-5-18(16)28)30-26(37)32-25(34)22-11-10-21(36-22)17-12-14(27)6-8-19(17)29/h2-13H,1H3,(H,31,33)(H2,30,32,34,37) |
| InChIKey | HVBXMZLJEAKFKW-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.87 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|