C22H16Cl3N3O3S — CID 17115543
2,5-dichloro-N-[[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]carbamothioyl]benzamide (PubChem CID 17115543) has the molecular formula C22H16Cl3N3O3S and a molecular weight of 508.81 g/mol. Its IUPAC name is 2,5-dichloro-N-[[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]carbamothioyl]benzamide.
| Compound Name | 2,5-dichloro-N-[[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17115543 |
| Molecular Formula | C22H16Cl3N3O3S |
| Molecular Weight | 508.81 g/mol |
| Exact Mass | 507.00 |
| IUPAC Name | 2,5-dichloro-N-[[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]carbamothioyl]benzamide |
| SMILES | COc1cc(NC(=S)NC(=O)c2cc(Cl)ccc2Cl)ccc1NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H16Cl3N3O3S/c1-31-19-11-13(7-9-18(19)27-20(29)14-4-2-3-5-16(14)24)26-22(32)28-21(30)15-10-12(23)6-8-17(15)25/h2-11H,1H3,(H,27,29)(H2,26,28,30,32) |
| InChIKey | DWTICHFVRVLJSY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.81 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|