C20H15BrClN3O3S2 — CID 17317061
N-[4-[(5-bromo-2-chlorobenzoyl)carbamothioylamino]-2-methoxyphenyl]thiophene-2-carboxamide (PubChem CID 17317061) has the molecular formula C20H15BrClN3O3S2 and a molecular weight of 524.85 g/mol. Its IUPAC name is N-[4-[(5-bromo-2-chlorobenzoyl)carbamothioylamino]-2-methoxyphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(5-bromo-2-chlorobenzoyl)carbamothioylamino]-2-methoxyphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17317061 |
| Molecular Formula | C20H15BrClN3O3S2 |
| Molecular Weight | 524.85 g/mol |
| Exact Mass | 522.94 |
| IUPAC Name | N-[4-[(5-bromo-2-chlorobenzoyl)carbamothioylamino]-2-methoxyphenyl]thiophene-2-carboxamide |
| SMILES | COc1cc(NC(=S)NC(=O)c2cc(Br)ccc2Cl)ccc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C20H15BrClN3O3S2/c1-28-16-10-12(5-7-15(16)24-19(27)17-3-2-8-30-17)23-20(29)25-18(26)13-9-11(21)4-6-14(13)22/h2-10H,1H3,(H,24,27)(H2,23,25,26,29) |
| InChIKey | RLRYXZMAPFZCBI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.85 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|