C22H19BrN2O4S — CID 17117563
N-[4-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]-2-methoxyphenyl]thiophene-2-carboxamide (PubChem CID 17117563) has the molecular formula C22H19BrN2O4S and a molecular weight of 487.38 g/mol. Its IUPAC name is N-[4-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]-2-methoxyphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]-2-methoxyphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17117563 |
| Molecular Formula | C22H19BrN2O4S |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | N-[4-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]-2-methoxyphenyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)Nc1ccc(NC(=O)c2cccs2)c(OC)c1 |
| InChI | InChI=1S/C22H19BrN2O4S/c1-28-18-9-6-15(23)12-14(18)5-10-21(26)24-16-7-8-17(19(13-16)29-2)25-22(27)20-4-3-11-30-20/h3-13H,1-2H3,(H,24,26)(H,25,27)/b10-5+ |
| InChIKey | LDUNOYVFSYSMPR-BJMVGYQFSA-N |
| XLogP | 5.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|