C16H14BrNO2 — CID 4989613
3-(5-bromo-2-methoxyphenyl)-N-phenylprop-2-enamide (PubChem CID 4989613) has the molecular formula C16H14BrNO2 and a molecular weight of 332.20 g/mol. Its IUPAC name is 3-(5-bromo-2-methoxyphenyl)-N-phenylprop-2-enamide.
| Compound Name | 3-(5-bromo-2-methoxyphenyl)-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 4989613 |
| Molecular Formula | C16H14BrNO2 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 3-(5-bromo-2-methoxyphenyl)-N-phenylprop-2-enamide |
| SMILES | COc1ccc(Br)cc1C=CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H14BrNO2/c1-20-15-9-8-13(17)11-12(15)7-10-16(19)18-14-5-3-2-4-6-14/h2-11H,1H3,(H,18,19) |
| InChIKey | KRQXDQYKDADSGO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|