C19H18BrNO4 — CID 17341954
[3-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]phenyl] propanoate (PubChem CID 17341954) has the molecular formula C19H18BrNO4 and a molecular weight of 404.26 g/mol. Its IUPAC name is [3-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]phenyl] propanoate.
| Compound Name | [3-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]phenyl] propanoate |
|---|---|
| PubChem CID | 17341954 |
| Molecular Formula | C19H18BrNO4 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | [3-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(NC(=O)/C=C/c2cc(Br)ccc2OC)c1 |
| InChI | InChI=1S/C19H18BrNO4/c1-3-19(23)25-16-6-4-5-15(12-16)21-18(22)10-7-13-11-14(20)8-9-17(13)24-2/h4-12H,3H2,1-2H3,(H,21,22)/b10-7+ |
| InChIKey | MOWSYRZCXKEVPU-JXMROGBWSA-N |
| XLogP | 4.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|