C17H15BrClNO3 — CID 1116370
(E)-3-(5-bromo-2-methoxyphenyl)-N-(3-chloro-4-methoxyphenyl)prop-2-enamide (PubChem CID 1116370) has the molecular formula C17H15BrClNO3 and a molecular weight of 396.67 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-methoxyphenyl)-N-(3-chloro-4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(3-chloro-4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1116370 |
| Molecular Formula | C17H15BrClNO3 |
| Molecular Weight | 396.67 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(3-chloro-4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2cc(Br)ccc2OC)cc1Cl |
| InChI | InChI=1S/C17H15BrClNO3/c1-22-15-6-4-12(18)9-11(15)3-8-17(21)20-13-5-7-16(23-2)14(19)10-13/h3-10H,1-2H3,(H,20,21)/b8-3+ |
| InChIKey | SSNIBGUCMHRCND-FPYGCLRLSA-N |
| XLogP | 4.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.67 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|