C20H20BrClN2O3 — CID 2447641
N-[3-[[(Z)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]-4-chlorophenyl]butanamide (PubChem CID 2447641) has the molecular formula C20H20BrClN2O3 and a molecular weight of 451.75 g/mol. Its IUPAC name is N-[3-[[(Z)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]-4-chlorophenyl]butanamide.
| Compound Name | N-[3-[[(Z)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]-4-chlorophenyl]butanamide |
|---|---|
| PubChem CID | 2447641 |
| Molecular Formula | C20H20BrClN2O3 |
| Molecular Weight | 451.75 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | N-[3-[[(Z)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]-4-chlorophenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=O)/C=C\c2cc(Br)ccc2OC)c1 |
| InChI | InChI=1S/C20H20BrClN2O3/c1-3-4-19(25)23-15-7-8-16(22)17(12-15)24-20(26)10-5-13-11-14(21)6-9-18(13)27-2/h5-12H,3-4H2,1-2H3,(H,23,25)(H,24,26)/b10-5- |
| InChIKey | HEFCMMVMIQWULO-YHYXMXQVSA-N |
| XLogP | 5.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.75 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|