C21H21BrClN3O3S — CID 6134723
N-[3-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]carbamothioylamino]-4-chlorophenyl]butanamide (PubChem CID 6134723) has the molecular formula C21H21BrClN3O3S and a molecular weight of 510.84 g/mol. Its IUPAC name is N-[3-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]carbamothioylamino]-4-chlorophenyl]butanamide.
| Compound Name | N-[3-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]carbamothioylamino]-4-chlorophenyl]butanamide |
|---|---|
| PubChem CID | 6134723 |
| Molecular Formula | C21H21BrClN3O3S |
| Molecular Weight | 510.84 g/mol |
| Exact Mass | 509.02 |
| IUPAC Name | N-[3-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]carbamothioylamino]-4-chlorophenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=S)NC(=O)/C=C/c2cc(Br)ccc2OC)c1 |
| InChI | InChI=1S/C21H21BrClN3O3S/c1-3-4-19(27)24-15-7-8-16(23)17(12-15)25-21(30)26-20(28)10-5-13-11-14(22)6-9-18(13)29-2/h5-12H,3-4H2,1-2H3,(H,24,27)(H2,25,26,28,30)/b10-5+ |
| InChIKey | YNGJPRIGXUACRB-BJMVGYQFSA-N |
| XLogP | 5.38 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.84 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|