C18H17ClFN3O2S — CID 4510137
N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-4-fluorobenzamide (PubChem CID 4510137) has the molecular formula C18H17ClFN3O2S and a molecular weight of 393.87 g/mol. Its IUPAC name is N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-4-fluorobenzamide.
| Compound Name | N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 4510137 |
| Molecular Formula | C18H17ClFN3O2S |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-4-fluorobenzamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=S)NC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H17ClFN3O2S/c1-2-3-16(24)21-13-8-9-14(19)15(10-13)22-18(26)23-17(25)11-4-6-12(20)7-5-11/h4-10H,2-3H2,1H3,(H,21,24)(H2,22,23,25,26) |
| InChIKey | VSHIINJNXRILBZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|