C14H8Cl3FN2OS — CID 2281952
4-fluoro-N-[(2,4,5-trichlorophenyl)carbamothioyl]benzamide (PubChem CID 2281952) has the molecular formula C14H8Cl3FN2OS and a molecular weight of 377.66 g/mol. Its IUPAC name is 4-fluoro-N-[(2,4,5-trichlorophenyl)carbamothioyl]benzamide.
| Compound Name | 4-fluoro-N-[(2,4,5-trichlorophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2281952 |
| Molecular Formula | C14H8Cl3FN2OS |
| Molecular Weight | 377.66 g/mol |
| Exact Mass | 375.94 |
| IUPAC Name | 4-fluoro-N-[(2,4,5-trichlorophenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cc(Cl)c(Cl)cc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H8Cl3FN2OS/c15-9-5-11(17)12(6-10(9)16)19-14(22)20-13(21)7-1-3-8(18)4-2-7/h1-6H,(H2,19,20,21,22) |
| InChIKey | MUDPKBWRTAPHOA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|