C14H7Cl3N4OS2 — CID 17313864
N-[(2,4,5-trichlorophenyl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 17313864) has the molecular formula C14H7Cl3N4OS2 and a molecular weight of 417.73 g/mol. Its IUPAC name is N-[(2,4,5-trichlorophenyl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-[(2,4,5-trichlorophenyl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17313864 |
| Molecular Formula | C14H7Cl3N4OS2 |
| Molecular Weight | 417.73 g/mol |
| Exact Mass | 415.91 |
| IUPAC Name | N-[(2,4,5-trichlorophenyl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | O=C(NC(=S)Nc1cc(Cl)c(Cl)cc1Cl)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C14H7Cl3N4OS2/c15-7-4-9(17)11(5-8(7)16)18-14(23)19-13(22)6-1-2-10-12(3-6)21-24-20-10/h1-5H,(H2,18,19,22,23) |
| InChIKey | GVXDYZBQKLQETL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|