C15H12N4O2S — CID 2037551
N-(4-acetamidophenyl)-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 2037551) has the molecular formula C15H12N4O2S and a molecular weight of 312.35 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 2037551 |
| Molecular Formula | C15H12N4O2S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-(4-acetamidophenyl)-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2ccc3nsnc3c2)cc1 |
| InChI | InChI=1S/C15H12N4O2S/c1-9(20)16-11-3-5-12(6-4-11)17-15(21)10-2-7-13-14(8-10)19-22-18-13/h2-8H,1H3,(H,16,20)(H,17,21) |
| InChIKey | TWFGPJDBOGJHNN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |