C13H7FN4O3S — CID 17099336
N-(4-fluoro-3-nitrophenyl)-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 17099336) has the molecular formula C13H7FN4O3S and a molecular weight of 318.29 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17099336 |
| Molecular Formula | C13H7FN4O3S |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)c([N+](=O)[O-])c1)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C13H7FN4O3S/c14-9-3-2-8(6-12(9)18(20)21)15-13(19)7-1-4-10-11(5-7)17-22-16-10/h1-6H,(H,15,19) |
| InChIKey | YBHLZLJTKXOXJR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|