C14H9N3O3S — CID 773424
N-(2,1,3-benzothiadiazol-5-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 773424) has the molecular formula C14H9N3O3S and a molecular weight of 299.31 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-5-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(2,1,3-benzothiadiazol-5-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 773424 |
| Molecular Formula | C14H9N3O3S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-5-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc2nsnc2c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H9N3O3S/c18-14(8-1-4-12-13(5-8)20-7-19-12)15-9-2-3-10-11(6-9)17-21-16-10/h1-6H,7H2,(H,15,18) |
| InChIKey | UZUWOKVIPPJUMN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |