C15H10N2O4 — CID 110388239
N-(1,3-benzodioxol-5-yl)-1,3-benzoxazole-5-carboxamide (PubChem CID 110388239) has the molecular formula C15H10N2O4 and a molecular weight of 282.25 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 110388239 |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1,3-benzoxazole-5-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc2ocnc2c1 |
| InChI | InChI=1S/C15H10N2O4/c18-15(9-1-3-12-11(5-9)16-7-19-12)17-10-2-4-13-14(6-10)21-8-20-13/h1-7H,8H2,(H,17,18) |
| InChIKey | ICAZFYLSUVIRER-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |