C14H9Br2NO3 — CID 107980044
N-(1,3-benzodioxol-5-yl)-3,5-dibromobenzamide (PubChem CID 107980044) has the molecular formula C14H9Br2NO3 and a molecular weight of 399.04 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3,5-dibromobenzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3,5-dibromobenzamide |
|---|---|
| PubChem CID | 107980044 |
| Molecular Formula | C14H9Br2NO3 |
| Molecular Weight | 399.04 g/mol |
| Exact Mass | 396.89 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3,5-dibromobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C14H9Br2NO3/c15-9-3-8(4-10(16)5-9)14(18)17-11-1-2-12-13(6-11)20-7-19-12/h1-6H,7H2,(H,17,18) |
| InChIKey | BAGZQOMKJFYRHL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.04 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |