C13H9NO6 — CID 104606905
5-(1,3-benzodioxol-5-ylcarbamoyl)furan-3-carboxylic acid (PubChem CID 104606905) has the molecular formula C13H9NO6 and a molecular weight of 275.22 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylcarbamoyl)furan-3-carboxylic acid.
| Compound Name | 5-(1,3-benzodioxol-5-ylcarbamoyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104606905 |
| Molecular Formula | C13H9NO6 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylcarbamoyl)furan-3-carboxylic acid |
| SMILES | O=C(O)c1coc(C(=O)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C13H9NO6/c15-12(11-3-7(5-18-11)13(16)17)14-8-1-2-9-10(4-8)20-6-19-9/h1-5H,6H2,(H,14,15)(H,16,17) |
| InChIKey | SRRXRMLEMDYQOC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |