C12H8ClNO4 — CID 113432211
5-[(3-chlorophenyl)carbamoyl]furan-3-carboxylic acid (PubChem CID 113432211) has the molecular formula C12H8ClNO4 and a molecular weight of 265.65 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)carbamoyl]furan-3-carboxylic acid.
| Compound Name | 5-[(3-chlorophenyl)carbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 113432211 |
| Molecular Formula | C12H8ClNO4 |
| Molecular Weight | 265.65 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 5-[(3-chlorophenyl)carbamoyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1coc(C(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C12H8ClNO4/c13-8-2-1-3-9(5-8)14-11(15)10-4-7(6-18-10)12(16)17/h1-6H,(H,14,15)(H,16,17) |
| InChIKey | OZYNTNZAUMNWFP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.65 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |