C13H10N2O5 — CID 104607017
5-[(4-carbamoylphenyl)carbamoyl]furan-3-carboxylic acid (PubChem CID 104607017) has the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. Its IUPAC name is 5-[(4-carbamoylphenyl)carbamoyl]furan-3-carboxylic acid.
| Compound Name | 5-[(4-carbamoylphenyl)carbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104607017 |
| Molecular Formula | C13H10N2O5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 5-[(4-carbamoylphenyl)carbamoyl]furan-3-carboxylic acid |
| SMILES | NC(=O)c1ccc(NC(=O)c2cc(C(=O)O)co2)cc1 |
| InChI | InChI=1S/C13H10N2O5/c14-11(16)7-1-3-9(4-2-7)15-12(17)10-5-8(6-20-10)13(18)19/h1-6H,(H2,14,16)(H,15,17)(H,18,19) |
| InChIKey | IKFIVTVJUWAKHR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |