C22H18N4O4 — CID 1272826
1-N,4-N-bis(4-carbamoylphenyl)benzene-1,4-dicarboxamide (PubChem CID 1272826) has the molecular formula C22H18N4O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is 1-N,4-N-bis(4-carbamoylphenyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(4-carbamoylphenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 1272826 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1-N,4-N-bis(4-carbamoylphenyl)benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(NC(=O)c2ccc(C(=O)Nc3ccc(C(N)=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H18N4O4/c23-19(27)13-5-9-17(10-6-13)25-21(29)15-1-2-16(4-3-15)22(30)26-18-11-7-14(8-12-18)20(24)28/h1-12H,(H2,23,27)(H2,24,28)(H,25,29)(H,26,30) |
| InChIKey | TUZOZPOOJSNSBB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |