C18H13N5O2 — CID 168545506
4-[[4-(2,2-dicyanoethenylamino)benzoyl]amino]benzamide (PubChem CID 168545506) has the molecular formula C18H13N5O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 4-[[4-(2,2-dicyanoethenylamino)benzoyl]amino]benzamide.
| Compound Name | 4-[[4-(2,2-dicyanoethenylamino)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 168545506 |
| Molecular Formula | C18H13N5O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 4-[[4-(2,2-dicyanoethenylamino)benzoyl]amino]benzamide |
| SMILES | N#CC(C#N)=CNc1ccc(C(=O)Nc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C18H13N5O2/c19-9-12(10-20)11-22-15-5-3-14(4-6-15)18(25)23-16-7-1-13(2-8-16)17(21)24/h1-8,11,22H,(H2,21,24)(H,23,25) |
| InChIKey | HABIGDDTOITXJH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|