C16H12N4O2 — CID 168542050
N-[4-(2,2-dicyanoethenylamino)phenyl]-5-methylfuran-2-carboxamide (PubChem CID 168542050) has the molecular formula C16H12N4O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is N-[4-(2,2-dicyanoethenylamino)phenyl]-5-methylfuran-2-carboxamide.
| Compound Name | N-[4-(2,2-dicyanoethenylamino)phenyl]-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 168542050 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-[4-(2,2-dicyanoethenylamino)phenyl]-5-methylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(NC=C(C#N)C#N)cc2)o1 |
| InChI | InChI=1S/C16H12N4O2/c1-11-2-7-15(22-11)16(21)20-14-5-3-13(4-6-14)19-10-12(8-17)9-18/h2-7,10,19H,1H3,(H,20,21) |
| InChIKey | WLBGUTMGHLRGRD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|