C14H15NO2 — CID 844275
N-(3,4-dimethylphenyl)-5-methylfuran-2-carboxamide (PubChem CID 844275) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-5-methylfuran-2-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 844275 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-(3,4-dimethylphenyl)-5-methylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C)c(C)c2)o1 |
| InChI | InChI=1S/C14H15NO2/c1-9-4-6-12(8-10(9)2)15-14(16)13-7-5-11(3)17-13/h4-8H,1-3H3,(H,15,16) |
| InChIKey | CSQFCMFIKCILBU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |