C15H17NO2 — CID 2988789
N-(3,4-dimethylphenyl)-4,5-dimethylfuran-2-carboxamide (PubChem CID 2988789) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4,5-dimethylfuran-2-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-4,5-dimethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 2988789 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4,5-dimethylfuran-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(C)c(C)o2)cc1C |
| InChI | InChI=1S/C15H17NO2/c1-9-5-6-13(7-10(9)2)16-15(17)14-8-11(3)12(4)18-14/h5-8H,1-4H3,(H,16,17) |
| InChIKey | PCHLPWDHGUEDSM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |