C18H21NO — CID 163590509
N-(3,4-dimethylphenyl)-2,3,4-trimethylbenzamide (PubChem CID 163590509) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2,3,4-trimethylbenzamide.
| Compound Name | N-(3,4-dimethylphenyl)-2,3,4-trimethylbenzamide |
|---|---|
| PubChem CID | 163590509 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2,3,4-trimethylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(C)c(C)c2C)cc1C |
| InChI | InChI=1S/C18H21NO/c1-11-6-8-16(10-13(11)3)19-18(20)17-9-7-12(2)14(4)15(17)5/h6-10H,1-5H3,(H,19,20) |
| InChIKey | MPPGUASKNJNGGJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |