C17H15NO5 — CID 15943706
4-[(3,4-dimethylphenyl)carbamoyl]benzene-1,3-dicarboxylic acid (PubChem CID 15943706) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)carbamoyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[(3,4-dimethylphenyl)carbamoyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 15943706 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)carbamoyl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1ccc(NC(=O)c2ccc(C(=O)O)cc2C(=O)O)cc1C |
| InChI | InChI=1S/C17H15NO5/c1-9-3-5-12(7-10(9)2)18-15(19)13-6-4-11(16(20)21)8-14(13)17(22)23/h3-8H,1-2H3,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | POVHVUIKWDUNBF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |