C17H13NO5-2 — CID 7364814
2-[(3,4-dimethylphenyl)carbamoyl]terephthalate (PubChem CID 7364814) has the molecular formula C17H13NO5-2 and a molecular weight of 311.29 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)carbamoyl]terephthalate.
| Compound Name | 2-[(3,4-dimethylphenyl)carbamoyl]terephthalate |
|---|---|
| PubChem CID | 7364814 |
| Molecular Formula | C17H13NO5-2 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)carbamoyl]terephthalate |
| SMILES | Cc1ccc(NC(=O)c2cc(C(=O)[O-])ccc2C(=O)[O-])cc1C |
| InChI | InChI=1S/C17H15NO5/c1-9-3-5-12(7-10(9)2)18-15(19)14-8-11(16(20)21)4-6-13(14)17(22)23/h3-8H,1-2H3,(H,18,19)(H,20,21)(H,22,23)/p-2 |
| InChIKey | FRKOXAYCFPCIAZ-UHFFFAOYSA-L |
| XLogP | 0.28 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |