C38H34N4O4 — CID 4945134
1-N,4-N-bis[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]benzene-1,4-dicarboxamide (PubChem CID 4945134) has the molecular formula C38H34N4O4 and a molecular weight of 610.71 g/mol. Its IUPAC name is 1-N,4-N-bis[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 4945134 |
| Molecular Formula | C38H34N4O4 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | 1-N,4-N-bis[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]benzene-1,4-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=O)c2ccc(C(=O)Nc3ccccc3C(=O)Nc3ccc(C)c(C)c3)cc2)cc1C |
| InChI | InChI=1S/C38H34N4O4/c1-23-13-19-29(21-25(23)3)39-37(45)31-9-5-7-11-33(31)41-35(43)27-15-17-28(18-16-27)36(44)42-34-12-8-6-10-32(34)38(46)40-30-20-14-24(2)26(4)22-30/h5-22H,1-4H3,(H,39,45)(H,40,46)(H,41,43)(H,42,44) |
| InChIKey | RCMNXLMVQMBWCA-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |