C36H38N4O4 — CID 4945136
N,N'-bis[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]hexanediamide (PubChem CID 4945136) has the molecular formula C36H38N4O4 and a molecular weight of 590.72 g/mol. Its IUPAC name is N,N'-bis[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]hexanediamide.
| Compound Name | N,N'-bis[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 4945136 |
| Molecular Formula | C36H38N4O4 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | N,N'-bis[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]hexanediamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=O)CCCCC(=O)Nc2ccccc2C(=O)Nc2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C36H38N4O4/c1-23-17-19-27(21-25(23)3)37-35(43)29-11-5-7-13-31(29)39-33(41)15-9-10-16-34(42)40-32-14-8-6-12-30(32)36(44)38-28-20-18-24(2)26(4)22-28/h5-8,11-14,17-22H,9-10,15-16H2,1-4H3,(H,37,43)(H,38,44)(H,39,41)(H,40,42) |
| InChIKey | BLFCJYBJPOOGDQ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|